CAS 124649-78-1

(-)-Dihydroguaiaretic acid

Description:

(-)-Dihydroguaiaretic acid, with the CAS number 124649-78-1, is a naturally occurring compound primarily derived from the plant species Guaiacum officinale. It is classified as a phenolic compound and is known for its potential anti-inflammatory and antioxidant properties. The substance exhibits a chiral structure, with the "(-)" designation indicating its specific stereochemistry, which can influence its biological activity. (-)-Dihydroguaiaretic acid has been studied for its role in traditional medicine and its potential therapeutic applications, particularly in the context of respiratory health and immune modulation. In terms of solubility, it is generally soluble in organic solvents but may have limited solubility in water. Its molecular structure features multiple hydroxyl groups, contributing to its reactivity and interaction with various biological systems. Overall, (-)-Dihydroguaiaretic acid represents a compound of interest in both pharmacological research and natural product chemistry.

Formula: C₂₀H₂₆O₄

InChI: InChI=1S/C20H26O4/c1-13(9-15-5-7-17(21)19(11-15)23-3)14(2)10-16-6-8-18(22)20(12-16)24-4/h5-8,11-14,21-22H,9-10H2,1-4H3/t13-,14-/m1/s1

InChI key: InChIKey=ADFOLUXMYYCTRR-ZIAGYGMSSA-N

SMILES: C([C@H]([C@@H](CC1=CC(OC)=C(O)C=C1)C)C)C2=CC(OC)=C(O)C=C2

Synonyms:

• Phenol, 4,4′-[(2R,3R)-2,3-dimethyl-1,4-butanediyl]bis[2-methoxy-
• (-)-Dihydroguaiaretic acid
• 4,4′-[(2R,3R)-2,3-Dimethyl-1,4-butanediyl]bis[2-methoxyphenol]
• Phenol, 4,4′-(2,3-dimethyl-1,4-butanediyl)bis[2-methoxy-, [R-(R*,R*)]-

(-)-Dihydroguaiaretic acid

CAS: 124649-78-1

(-)-Dihydroguaiaretic acid is a type of lignan, which is a class of polyphenolic compounds. It is derived from various plant sources, including some species of gymnosperms and angiosperms. The mode of action of (-)-Dihydroguaiaretic acid involves its potent antioxidant capabilities, where it neutralizes free radicals and reactive oxygen species, thereby reducing oxidative stress. Additionally, it exhibits anti-inflammatory properties by modulating signaling pathways involved in inflammation.

Formula: C₂₀H₂₆O₄

Purity: Min. 95%

Molecular weight: 330.40 g/mol

Ref: 3D-ZEA64978