CAS 124654-22-4
:N-(iodoallyl)spiperone
Description:
N-(iodoallyl)spiperone is a chemical compound that belongs to the class of spiperone derivatives, which are known for their pharmacological properties, particularly in the field of neuroscience. This compound features an iodoallyl group, which contributes to its reactivity and potential biological activity. The presence of the iodine atom can enhance the lipophilicity of the molecule, potentially affecting its ability to cross biological membranes and interact with various receptors. Spiperone itself is recognized for its affinity for dopamine and serotonin receptors, making derivatives like N-(iodoallyl)spiperone of interest in research related to psychiatric disorders and neuropharmacology. The compound may exhibit unique binding characteristics and pharmacokinetics due to the modifications introduced by the iodoallyl group. Its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in studies exploring receptor interactions, signaling pathways, and the development of therapeutic agents. As with many chemical substances, safety and handling precautions are essential due to potential toxicity and reactivity.
Formula:C26H29FIN3O2
InChI:InChI=1/C26H29FIN3O2/c27-22-11-9-21(10-12-22)24(32)8-4-16-29-18-13-26(14-19-29)25(33)30(17-5-15-28)20-31(26)23-6-2-1-3-7-23/h1-3,5-7,9-12,15H,4,8,13-14,16-20H2/b15-5+
Synonyms:- (E)-N-(Iodoallyl)spiperone
- (Z)-N-(Iodoallyl)spiperone
- Niasp
- 1,3,8-Triazaspiro(4.5)decan-4-one, 8-(4-(4-fluorophenyl)-4-oxobutyl)-3-(3-iodo-2-propenyl)-1-phenyl-, (E)-
- 8-[4-(4-fluorophenyl)-4-oxobutyl]-3-[(2E)-3-iodoprop-2-en-1-yl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one
- N-(Iodoallyl)spiperone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.