
CAS 1246548-65-1
:3-[(3-Fluorophenyl)methyl]-2-piperazinone
Description:
3-[(3-Fluorophenyl)methyl]-2-piperazinone is a chemical compound characterized by its piperazinone structure, which includes a piperazine ring substituted with a fluorophenyl group. This compound typically exhibits properties associated with piperazine derivatives, such as potential biological activity, including effects on the central nervous system or other pharmacological activities. The presence of the fluorine atom in the phenyl ring can influence the compound's lipophilicity, stability, and interaction with biological targets. The molecular structure suggests it may participate in hydrogen bonding due to the carbonyl group in the piperazinone moiety, which can enhance its solubility in polar solvents. Additionally, the compound may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in the development of new drugs. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the precise molecular interactions and the environment in which it is studied.
Formula:C11H13FN2O
InChI:InChI=1S/C11H13FN2O/c12-9-3-1-2-8(6-9)7-10-11(15)14-5-4-13-10/h1-3,6,10,13H,4-5,7H2,(H,14,15)
InChI key:InChIKey=YECRMAQBEIWPKB-UHFFFAOYSA-N
SMILES:C(C1=CC(F)=CC=C1)C2C(=O)NCCN2
Synonyms:- 2-Piperazinone, 3-[(3-fluorophenyl)methyl]-
- 3-[(3-Fluorophenyl)methyl]-2-piperazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.