CAS 1246548-87-7

1-Methyl-1H-pyrazole-5-carbothioamide

Description:

1-Methyl-1H-pyrazole-5-carbothioamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. This compound features a methyl group at the 1-position and a carbothioamide functional group at the 5-position, contributing to its unique reactivity and properties. It is typically a solid at room temperature and may exhibit solubility in polar organic solvents. The presence of the thioamide group suggests potential for hydrogen bonding and interactions with biological systems, making it of interest in medicinal chemistry and agrochemical applications. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced biological activity or altered physicochemical properties. As with many nitrogen-containing heterocycles, it may exhibit interesting electronic properties, making it a candidate for studies in coordination chemistry or as a ligand in metal complexes. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₅H₇N₃S

InChI: InChI=1S/C5H7N3S/c1-8-4(5(6)9)2-3-7-8/h2-3H,1H3,(H2,6,9)

InChI key: InChIKey=QGFCSPJEZVQHNC-UHFFFAOYSA-N

SMILES: C(N)(=S)C=1N(C)N=CC1

Synonyms:

• 1H-Pyrazole-5-carbothioamide, 1-methyl-
• 1-Methyl-1H-pyrazole-5-carbothioamide

1-Methyl-1H-pyrazole-5-carbothioamide

CAS: 1246548-87-7

Versatile small molecule scaffold

Formula: C₅H₇N₃S

Purity: Min. 95%

Molecular weight: 141.2 g/mol

Ref: 3D-WZB54887