CymitQuimica logo

CAS 124655-18-1

:

4-Fluoro-N-(1,2,3,4-tetrahydro-1-oxo-2-naphthalenyl)benzamide

Description:
4-Fluoro-N-(1,2,3,4-tetrahydro-1-oxo-2-naphthalenyl)benzamide, with the CAS number 124655-18-1, is a chemical compound that features a complex structure characterized by the presence of a fluorine atom, a benzamide moiety, and a tetrahydro-naphthalene ring system. The fluorine substitution typically enhances the compound's lipophilicity and may influence its biological activity. The tetrahydro-1-oxo-2-naphthalenyl group contributes to the compound's potential pharmacological properties, as naphthalene derivatives are often associated with various biological activities. This compound may exhibit properties such as anti-inflammatory, analgesic, or antitumor effects, depending on its specific interactions within biological systems. Its molecular structure suggests it could participate in hydrogen bonding due to the amide functional group, which may affect its solubility and reactivity. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including solvent, temperature, and the presence of other reagents.
Formula:C17H14FNO2
InChI:InChI=1S/C17H14FNO2/c18-13-8-5-12(6-9-13)17(21)19-15-10-7-11-3-1-2-4-14(11)16(15)20/h1-6,8-9,15H,7,10H2,(H,19,21)
InChI key:InChIKey=USLKFNQVASYPSI-UHFFFAOYSA-N
SMILES:O=C1C=2C(CCC1NC(=O)C3=CC=C(F)C=C3)=CC=CC2
Synonyms:
  • Benzamide, 4-fluoro-N-(1,2,3,4-tetrahydro-1-oxo-2-naphthalenyl)-
  • 4-Fluoro-N-(1,2,3,4-tetrahydro-1-oxo-2-naphthalenyl)benzamide
  • 2-(4-Fluorobenzamido)-1-tetralone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.