CymitQuimica logo

CAS 1246553-09-2

:

2-Benzothiazolepropanal

Description:
2-Benzothiazolepropanal is an organic compound characterized by its unique structure, which includes a benzothiazole moiety and an aldehyde functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and applications in various chemical contexts. The presence of the benzothiazole ring imparts certain stability and may influence its solubility in organic solvents. As an aldehyde, it is likely to participate in typical reactions of carbonyl compounds, such as nucleophilic addition and condensation reactions. Additionally, 2-Benzothiazolepropanal may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its specific applications can vary, but it may be explored in the development of pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 2-Benzothiazolepropanal represents a versatile compound with diverse implications in chemical research and industry.
Formula:C10H9NOS
InChI:InChI=1S/C10H9NOS/c12-7-3-6-10-11-8-4-1-2-5-9(8)13-10/h1-2,4-5,7H,3,6H2
InChI key:InChIKey=LSDFBHGIARTKDE-UHFFFAOYSA-N
SMILES:C(CC=O)C1=NC=2C(S1)=CC=CC2
Synonyms:
  • 2-Benzothiazolepropanal
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.