CymitQuimica logo

CAS 1246553-16-1

:

3-(4-Nitrophenyl)-2-piperazinone

Description:
3-(4-Nitrophenyl)-2-piperazinone is a chemical compound characterized by its piperazinone structure, which includes a piperazine ring and a nitrophenyl substituent. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating both nitrogen and oxygen atoms. The presence of the nitro group (-NO2) on the phenyl ring contributes to its potential reactivity and polarity, influencing its solubility in various solvents. The piperazinone moiety may impart biological activity, making it of interest in medicinal chemistry and pharmacology. Compounds like this are often studied for their potential therapeutic applications, including antimicrobial or antitumor properties. Additionally, the compound's stability, melting point, and spectral characteristics (such as NMR and IR) can provide insights into its chemical behavior and interactions. Overall, 3-(4-Nitrophenyl)-2-piperazinone represents a class of compounds that can be valuable in research and development within the field of organic chemistry and drug discovery.
Formula:C10H11N3O3
InChI:InChI=1S/C10H11N3O3/c14-10-9(11-5-6-12-10)7-1-3-8(4-2-7)13(15)16/h1-4,9,11H,5-6H2,(H,12,14)
InChI key:InChIKey=XXKGLOIHNKXWIH-UHFFFAOYSA-N
SMILES:O=C1C(C2=CC=C(N(=O)=O)C=C2)NCCN1
Synonyms:
  • 2-Piperazinone, 3-(4-nitrophenyl)-
  • 3-(4-Nitrophenyl)-2-piperazinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.