CAS 1246555-44-1

5-Bromothieno[3,2-b]pyridine

Description:

5-Bromothieno[3,2-b]pyridine is a heterocyclic organic compound characterized by the presence of both bromine and a fused thieno-pyridine structure. This compound features a five-membered thieno ring fused to a pyridine ring, which contributes to its unique chemical properties. The bromine substituent at the 5-position enhances its reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the thieno and pyridine moieties can influence its electronic properties, potentially affecting its behavior in various chemical reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Bromothieno[3,2-b]pyridine is a significant compound in the field of organic chemistry with diverse applications.

Formula: C₇H₄BrNS

InChI: InChI=1S/C7H4BrNS/c8-7-2-1-6-5(9-7)3-4-10-6/h1-4H

InChI key: InChIKey=VINXSDPSCQKXII-UHFFFAOYSA-N

SMILES: BrC=1N=C2C(=CC1)SC=C2

Synonyms:

• Thieno[3,2-b]pyridine, 5-bromo-
• 5-Bromothieno[3,2-b]pyridine

5-Bromothieno[3,2-b]pyridine

CAS: 1246555-44-1

Versatile small molecule scaffold

Formula: C₇H₄BrNS

Purity: Min. 95%

Molecular weight: 214.08 g/mol

Ref: 3D-WZB55544