
CAS 1246609-14-2
:α-Amino-6-bromo-3-pyridineacetic acid
Description:
α-Amino-6-bromo-3-pyridineacetic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the amino group (-NH2) indicates that it is an amino acid derivative, contributing to its potential biological activity. The bromine substituent at the 6-position of the pyridine ring introduces halogen characteristics, which can influence the compound's reactivity and solubility. This compound is likely to exhibit polar properties due to the amino and carboxylic acid functional groups, making it soluble in water and other polar solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the modifications on the pyridine ring can affect biological interactions. Additionally, the compound may participate in various chemical reactions typical of amino acids, such as peptide bond formation. Overall, α-Amino-6-bromo-3-pyridineacetic acid represents a versatile structure with implications in both synthetic and biological chemistry.
Formula:C7H7BrN2O2
InChI:InChI=1S/C7H7BrN2O2/c8-5-2-1-4(3-10-5)6(9)7(11)12/h1-3,6H,9H2,(H,11,12)
InChI key:InChIKey=QQSFWGYHRNMALM-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N)C=1C=CC(Br)=NC1
Synonyms:- α-Amino-6-bromo-3-pyridineacetic acid
- 3-Pyridineacetic acid, α-amino-6-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.