CAS 1246616-74-9: 2,5-Diethyl 4-oxo-4H-pyran-2,5-dicarboxylate

Description:2,5-Diethyl 4-oxo-4H-pyran-2,5-dicarboxylate is a chemical compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This substance features two ethyl groups attached to the 2 and 5 positions of the pyran ring, contributing to its hydrophobic properties. The presence of two carboxylate groups at the 2 and 5 positions enhances its reactivity and solubility in polar solvents. The ketone functionality at the 4 position introduces additional reactivity, making it a potential candidate for various chemical reactions, including condensation and cyclization. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in organic synthesis, particularly in the development of novel materials or pharmaceuticals. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound may vary.

Formula:C₁₁H₁₂O₆

InChI:InChI=1S/C11H12O6/c1-3-15-10(13)7-6-17-9(5-8(7)12)11(14)16-4-2/h5-6H,3-4H2,1-2H3

InChI key:InChIKey=RNIVGJYWHHSMKA-UHFFFAOYSA-N

SMILES:O=C(OCC)C=1OC=C(C(=O)OCC)C(=O)C1

Synonyms:
4H-Pyran-2,5-dicarboxylic acid, 4-oxo-, 2,5-diethyl ester
2,5-Diethyl 4-oxo-4H-pyran-2,5-dicarboxylate

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	4-Oxo-4H-pyran-2,5-dicarboxylic Acid 2,5-Diethyl Ester REF: TR-O858760CAS: 1246616-74-9	- - -	1,151.00 €	Tue 06 May 25
	4-Oxo-4H-pyran-2,5-dicarboxylic acid 2,5-diethyl ester REF: 3D-WZB61674CAS: 1246616-74-9	Min. 95%	- - -	Discontinued product