CAS 1246616-74-9: 2,5-Diethyl 4-oxo-4H-pyran-2,5-dicarboxylate
Description:2,5-Diethyl 4-oxo-4H-pyran-2,5-dicarboxylate is a chemical compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This substance features two ethyl groups attached to the 2 and 5 positions of the pyran ring, contributing to its hydrophobic properties. The presence of two carboxylate groups at the 2 and 5 positions enhances its reactivity and solubility in polar solvents. The ketone functionality at the 4 position introduces additional reactivity, making it a potential candidate for various chemical reactions, including condensation and cyclization. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in organic synthesis, particularly in the development of novel materials or pharmaceuticals. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound may vary.
Formula:C11H12O6
InChI:InChI=1S/C11H12O6/c1-3-15-10(13)7-6-17-9(5-8(7)12)11(14)16-4-2/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=RNIVGJYWHHSMKA-UHFFFAOYSA-N
SMILES:O=C(OCC)C=1OC=C(C(=O)OCC)C(=O)C1
- Synonyms:
- 4H-Pyran-2,5-dicarboxylic acid, 4-oxo-, 2,5-diethyl ester
- 2,5-Diethyl 4-oxo-4H-pyran-2,5-dicarboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Oxo-4H-pyran-2,5-dicarboxylic Acid 2,5-Diethyl Ester REF: TR-O858760CAS: 1246616-74-9 | - - - | 1,151.00 € | Tue 27 May 25 |
![]() | 4-Oxo-4H-pyran-2,5-dicarboxylic acid 2,5-diethyl ester REF: 3D-WZB61674CAS: 1246616-74-9 | Min. 95% | - - - | Discontinued product |

4-Oxo-4H-pyran-2,5-dicarboxylic Acid 2,5-Diethyl Ester
Controlled ProductRef: TR-O858760
250mg | 1,151.00 € |

4-Oxo-4H-pyran-2,5-dicarboxylic acid 2,5-diethyl ester
Ref: 3D-WZB61674
10mg | Discontinued | Request information | |
100mg | Discontinued | Request information |