CymitQuimica logo

CAS 1246636-86-1

:

3-(Methylamino)benzenepropanoic acid

Description:
3-(Methylamino)benzenepropanoic acid, also known as a derivative of phenylalanine, is an organic compound characterized by the presence of both an amino group and a carboxylic acid functional group. This compound features a benzene ring substituted with a methylamino group at the meta position relative to the propanoic acid chain. Its molecular structure contributes to its potential biological activity, particularly in relation to neurotransmitter pathways, as it may influence the synthesis or metabolism of certain neurotransmitters. The presence of the methylamino group enhances its solubility in polar solvents, while the carboxylic acid group allows for potential interactions with biological systems, such as forming salts or participating in hydrogen bonding. The compound's properties, including its melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. As with many amino acid derivatives, it may exhibit both hydrophilic and hydrophobic characteristics, making it relevant in various biochemical applications and studies.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-11-9-4-2-3-8(7-9)5-6-10(12)13/h2-4,7,11H,5-6H2,1H3,(H,12,13)
InChI key:InChIKey=HBXGCXABOYIPPP-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=CC(NC)=CC=C1
Synonyms:
  • 3-(Methylamino)benzenepropanoic acid
  • Benzenepropanoic acid, 3-(methylamino)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.