
CAS 1246668-88-1
:4-Hydroxy-3-pyridazinecarboxylic acid
Description:
4-Hydroxy-3-pyridazinecarboxylic acid, identified by its CAS number 1246668-88-1, is a heterocyclic organic compound featuring a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. This compound is characterized by the presence of a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to the pyridazine structure, contributing to its acidic properties. The hydroxyl group can participate in hydrogen bonding, enhancing its solubility in polar solvents. The compound may exhibit biological activity, making it of interest in pharmaceutical and agricultural research. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the presence of both functional groups allows for various chemical reactions, including esterification and amidation. Overall, 4-Hydroxy-3-pyridazinecarboxylic acid is a versatile compound with potential utility in various chemical and biological contexts.
Formula:C5H4N2O3
InChI:InChI=1S/C5H4N2O3/c8-3-1-2-6-7-4(3)5(9)10/h1-2H,(H,6,8)(H,9,10)
InChI key:InChIKey=IABMSFZLDSRRQZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C=CN=N1
Synonyms:- 3-Pyridazinecarboxylic acid, 4-hydroxy-
- 4-Hydroxy-3-pyridazinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.