
CAS 1246685-29-9
:2-Chloro-4-methoxybenzeneethanol
Description:
2-Chloro-4-methoxybenzeneethanol, also known by its CAS number 1246685-29-9, is an organic compound characterized by the presence of a chloro group and a methoxy group attached to a benzene ring, along with an ethanol moiety. This compound typically exhibits properties associated with aromatic alcohols, including moderate solubility in polar solvents due to the hydroxyl group, while maintaining some hydrophobic characteristics from the aromatic ring. The chloro substituent can influence its reactivity, making it a potential candidate for nucleophilic substitution reactions. The methoxy group can also affect the electronic properties of the molecule, potentially enhancing its reactivity in electrophilic aromatic substitution. In terms of applications, compounds with similar structures are often explored in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks. Overall, 2-Chloro-4-methoxybenzeneethanol represents a versatile structure in organic chemistry with potential utility in various chemical processes.
Formula:C9H11ClO2
InChI:InChI=1S/C9H11ClO2/c1-12-8-3-2-7(4-5-11)9(10)6-8/h2-3,6,11H,4-5H2,1H3
InChI key:InChIKey=TVSNMTRXMHTHCR-UHFFFAOYSA-N
SMILES:C(CO)C1=C(Cl)C=C(OC)C=C1
Synonyms:- Benzeneethanol, 2-chloro-4-methoxy-
- 2-Chloro-4-methoxybenzeneethanol
- 2-(2-Chloro-4-methoxyphenyl)ethan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.