CAS 1246738-25-9

Methyl 1,2,3,4-tetrahydro-1,3-dimethyl-2-oxo-6-quinoxalinecarboxylate

Description:

Methyl 1,2,3,4-tetrahydro-1,3-dimethyl-2-oxo-6-quinoxalinecarboxylate is a chemical compound characterized by its complex structure, which includes a quinoxaline ring fused with a tetrahydro moiety. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of methyl groups indicates that it may exhibit specific steric and electronic properties, influencing its behavior in chemical reactions. As a quinoxaline derivative, it may possess biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its solubility and stability would depend on the solvent and conditions used, which are critical for its practical applications. Overall, this compound represents a unique class of organic molecules with potential utility in pharmaceuticals and materials science, although specific data on its physical properties, such as melting point or boiling point, would require further investigation or experimental determination.

Formula: C₁₂H₁₄N₂O₃

InChI: InChI=1S/C12H14N2O3/c1-7-11(15)14(2)10-5-4-8(12(16)17-3)6-9(10)13-7/h4-7,13H,1-3H3

InChI key: InChIKey=RBASCXJWLKUEPY-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC(C(OC)=O)=CC2)NC(C)C1=O

Synonyms:

• Methyl 1,2,3,4-tetrahydro-1,3-dimethyl-2-oxo-6-quinoxalinecarboxylate
• 6-Quinoxalinecarboxylic acid, 1,2,3,4-tetrahydro-1,3-dimethyl-2-oxo-, methyl ester