CAS 1246738-32-8

1-(5-Chloro-4-methoxy-2-nitrophenyl)-1H-pyrrole

Description:

1-(5-Chloro-4-methoxy-2-nitrophenyl)-1H-pyrrole is an organic compound characterized by its unique structure, which includes a pyrrole ring fused with a substituted phenyl group. The presence of a chloro group, a methoxy group, and a nitro group on the phenyl ring contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The chloro substituent can enhance electrophilic aromatic substitution reactions, while the nitro group may serve as a functional handle for further chemical modifications. The methoxy group can influence the compound's solubility and electronic properties. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Additionally, its molecular interactions and stability can be influenced by the presence of these substituents, which may affect its behavior in different solvents and under varying conditions. Overall, 1-(5-Chloro-4-methoxy-2-nitrophenyl)-1H-pyrrole represents a complex molecule with diverse potential applications in chemical research.

Formula: C₁₁H₉ClN₂O₃

InChI: InChI=1S/C11H9ClN2O3/c1-17-11-7-10(14(15)16)9(6-8(11)12)13-4-2-3-5-13/h2-7H,1H3

InChI key: InChIKey=ILFYGBJSMQIDFB-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=C(Cl)C(OC)=C1)N2C=CC=C2

Synonyms:

• 1H-Pyrrole, 1-(5-chloro-4-methoxy-2-nitrophenyl)-
• 1-(5-Chloro-4-methoxy-2-nitrophenyl)-1H-pyrrole