CymitQuimica logo

CAS 1246761-85-2

:

B-(2-Methyl-4-thiazolyl)boronic acid

Description:
B-(2-Methyl-4-thiazolyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thiazole ring. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate melting point. The thiazole moiety contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. Boronic acids are known for their ability to form reversible covalent bonds with diols, which is a key feature in applications such as drug design and molecular recognition. Additionally, B-(2-Methyl-4-thiazolyl)boronic acid may participate in Suzuki coupling reactions, making it valuable in organic synthesis for constructing complex molecules. Its reactivity and functional versatility make it a significant compound in both research and industrial applications. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C4H6BNO2S
InChI:InChI=1S/C4H6BNO2S/c1-3-6-4(2-9-3)5(7)8/h2,7-8H,1H3
InChI key:InChIKey=NBEANWTXHVDYPB-UHFFFAOYSA-N
SMILES:B(O)(O)C=1N=C(C)SC1
Synonyms:
  • B-(2-Methyl-4-thiazolyl)boronic acid
  • Boronic acid, B-(2-methyl-4-thiazolyl)-
  • 2-Methylthiazole-4-boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.