
CAS 1246765-37-6
:3,4-Dihydro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-quinazolinone
Description:
3,4-Dihydro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-quinazolinone is a chemical compound characterized by its unique structural features, which include a quinazolinone core and a boron-containing substituent. The presence of the dioxaborolane moiety suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. The compound exhibits a bicyclic structure, which contributes to its stability and reactivity. Its functional groups may impart specific solubility characteristics, influencing its behavior in various solvents. Additionally, the presence of the tetramethyl groups enhances steric hindrance, potentially affecting its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to the biological activity often associated with quinazolinone derivatives. Overall, its unique structure and functional groups position it as a potentially valuable compound in both synthetic and pharmaceutical chemistry.
Formula:C14H19BN2O3
InChI:InChI=1S/C14H19BN2O3/c1-13(2)14(3,4)20-15(19-13)10-5-6-11-9(7-10)8-16-12(18)17-11/h5-7H,8H2,1-4H3,(H2,16,17,18)
InChI key:InChIKey=SKQNEIYOMWPKEF-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C3C(=CC2)NC(=O)NC3
Synonyms:- 2(1H)-Quinazolinone, 3,4-dihydro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 3,4-Dihydro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2(1H)-quinazolinone
- 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroquinazolin-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.