
CAS 1246767-56-5
:3-Pyridinamine, 6-phenyl-, hydrochloride (1:2)
Description:
3-Pyridinamine, 6-phenyl-, hydrochloride (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) at the 3-position and a phenyl group (C6H5) at the 6-position of the pyridine ring, contributing to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and other polar solvents. The presence of the hydrochloride indicates that the compound is protonated, which can influence its biological activity and interaction with other molecules. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C11H10N2·2ClH
InChI:InChI=1S/C11H10N2.2ClH/c12-10-6-7-11(13-8-10)9-4-2-1-3-5-9;;/h1-8H,12H2;2*1H
InChI key:InChIKey=MMWLZANHNOERGB-UHFFFAOYSA-N
SMILES:NC1=CC=C(N=C1)C2=CC=CC=C2.Cl
Synonyms:- 3-Pyridinamine, 6-phenyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.