CymitQuimica logo

CAS 124678-01-9

:

BENZYL CIS-(6-HYDROXYMETHYL)CYCLOHEX-3-ENYLCARBAMATE

Description:
Benzyl cis-(6-hydroxymethyl)cyclohex-3-enylcarbamate is a chemical compound characterized by its unique structural features, which include a benzyl group, a cyclohexene ring, and a carbamate functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the hydroxymethyl group enhances its polarity, which may influence its interactions in biological systems. As a carbamate, it may also exhibit characteristics typical of this functional group, such as potential biological activity and the ability to form hydrogen bonds. The compound's stereochemistry, indicated by the "cis" configuration, suggests specific spatial arrangements that can affect its chemical behavior and interactions. While specific applications or biological activities may vary, compounds of this nature are often explored in medicinal chemistry and materials science for their potential therapeutic properties or as intermediates in organic synthesis.
Formula:C16H21NO3
InChI:InChI=1/C16H21NO3/c1-17(15-10-6-5-9-14(15)11-18)16(19)20-12-13-7-3-2-4-8-13/h2-8,14-15,18H,9-12H2,1H3/t14-,15-/m0/s1
SMILES:CN([C@H]1CC=CC[C@H]1CO)C(=O)OCc1ccccc1
Synonyms:
  • Carbamic acid, [(1R,6S)-6-(hydroxymethyl)-3-cyclohexen-1-yl]-, phenylmethyl ester, rel- (9CI)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.