CAS 1246814-55-0
:Description:
The chemical substance with the CAS number 1246814-55-0 is known as a specific compound, but detailed characteristics such as its name, molecular formula, structure, and properties are not widely available in public databases. Generally, compounds with unique CAS numbers may belong to specialized fields such as pharmaceuticals, agrochemicals, or materials science. Characteristics typically assessed for such substances include their physical state (solid, liquid, or gas), solubility in various solvents, melting and boiling points, reactivity with other chemicals, and potential applications. Additionally, safety data such as toxicity, handling precautions, and environmental impact are crucial for understanding the compound's behavior in different contexts. For precise information, consulting specialized chemical databases, scientific literature, or safety data sheets (SDS) is recommended, as they provide comprehensive details about the compound's identity and characteristics.
Formula:C16H13ClD3NO2S·H2O4S
InChI:InChI=1S/C16H16ClNO2S.H2O4S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;1-5(2,3)4/h2-5,7,9,15H,6,8,10H2,1H3;(H2,1,2,3,4)/i1+1D3;
InChI key:InChIKey=FDEODCTUSIWGLK-SPZGMPHYSA-N
SMILES:C(C(O[13C]([2H])([2H])[2H])=O)(N1CC2=C(CC1)SC=C2)C3=C(Cl)C=CC=C3.S(=O)(=O)(O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
rac Clopidogrel-13C,d3 Hydrogen Sulfate
CAS:Controlled ProductApplications Labelled Clopidogrel, an antithrombotic.
References Mills, D.C.B., et al.: Arterioscler. Thromb., 12, 430 (1992), Feuerstein, G., et al.: Exp. Opin. Invest. Drugs, 4, 425 (1995)Formula:CC152H3H13ClNO2S·H2O4SColor and Shape:NeatMolecular weight:423.91
