CAS 1246814-74-3
:6-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-2-[[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]sulfinyl]-1H-benzimidazole
Description:
The chemical substance known as 6-[[[1,1-Dimethylethyl)dimethylsilyl]oxy]-2-[[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]sulfinyl]-1H-benzimidazole, with CAS number 1246814-74-3, is a complex organic compound characterized by its unique structural features. It contains a benzimidazole core, which is a bicyclic structure known for its biological activity, particularly in pharmaceuticals. The presence of a dimethylsilyl group suggests potential applications in enhancing solubility or stability, while the trifluoroethoxy group may impart specific electronic properties or lipophilicity. The sulfinyl moiety indicates the presence of sulfur, which can influence the compound's reactivity and interaction with biological targets. This compound's intricate structure suggests potential utility in medicinal chemistry, possibly as a therapeutic agent, although specific biological activities would require further investigation. Overall, its unique combination of functional groups and structural elements positions it as a compound of interest in both synthetic and applied chemistry contexts.
Formula:C22H28F3N3O3SSi
InChI:InChI=1S/C22H28F3N3O3SSi/c1-14-18(26-10-9-19(14)30-13-22(23,24)25)12-32(29)20-27-16-8-7-15(11-17(16)28-20)31-33(5,6)21(2,3)4/h7-11H,12-13H2,1-6H3,(H,27,28)
InChI key:InChIKey=ZZJAXCWRAVWBSG-UHFFFAOYSA-N
SMILES:S(CC1=C(C)C(OCC(F)(F)F)=CC=N1)(=O)C=2NC=3C(N2)=CC=C(O[Si](C(C)(C)C)(C)C)C3
Synonyms:- 1H-Benzimidazole, 6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-[[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]sulfinyl]-
- 6-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-2-[[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]sulfinyl]-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-O-tert-Butyldimethylsilyl 5-Hydroxy Lansoprazole
CAS:Controlled ProductApplications Protected Lansoprazole metabolite.
Formula:C22H28F3N3O3SSiColor and Shape:NeatMolecular weight:499.62
