
CAS 1246814-76-5
:Dapoxetine-d6 Hydrochloride
Description:
The chemical substance with the CAS number 1246814-76-5 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds can be characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), and chemical properties (including reactivity and stability). Additionally, the compound may have specific applications in fields such as pharmaceuticals, materials science, or agriculture, depending on its functional groups and overall structure. To obtain precise details about this compound, including its safety data, toxicity, and potential uses, it is advisable to consult specialized chemical databases or scientific literature. Always ensure to handle chemical substances with appropriate safety measures and guidelines.
Formula:C21H24ClNO
InChI:InChI=1S/C21H23NO.ClH/c1-22(2)20(18-10-4-3-5-11-18)15-16-23-21-14-8-12-17-9-6-7-13-19(17)21;/h3-14,20H,15-16H2,1-2H3;1H/t20-;/m0./s1/i1D3,2D3;
InChI key:InChIKey=IHWDIQRWYNMKFM-RURDCJKXSA-N
SMILES:O(CC[C@H](N(C([2H])([2H])[2H])C([2H])([2H])[2H])C1=CC=CC=C1)C=2C3=C(C=CC2)C=CC=C3.Cl
Synonyms:- (1S)-3-Naphthalen-1-yloxy-1-phenyl-N,N-bis(trideuteriomethyl)propan-1-amine hydrochloride
- LY-210448-d6
- Dapoxetine D6 hydrochloride Q: What are the applications of
- [2H6]-Dapoxetine hydrochloride
- Dapoxetine D6 hydrochloride Q: What is the storage condition of
- (αS)-N,N-(DiMethyl-d6)-α-[2-(1-naphthalenyloxy)ethyl]benzeneMethanaMine
- Dapoxetine D6 hydrochlorideQ: What is
- Dapoxetine D6 hydrochloride Q: What is the CAS Number of
- Dapoxetine-d6 Hydrochloride
- Dapoxetine hydrochloride salt
- Dapoxetine D6 hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dapoxetine-d6 Hydrochloride
CAS:Controlled Product<p>Applications Labelled Dapoxetine (D185700). Selective serotonin reuptake inhibitor (SSRI).<br>References Feret, B., et al.: Formulary, 40, 227 (2005),<br></p>Formula:C21H18D6ClNOColor and Shape:NeatMolecular weight:347.91
