CAS 1246816-01-2

(2R)-5-Bromo-2,3-dihydro-1H-inden-2-ol

Description:

(2R)-5-Bromo-2,3-dihydro-1H-inden-2-ol is a chemical compound characterized by its unique bicyclic structure, which includes a bromine substituent and a hydroxyl group. This compound belongs to the class of indene derivatives, which are known for their aromatic properties and potential applications in organic synthesis and medicinal chemistry. The presence of the bromine atom introduces notable reactivity, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The hydroxyl group contributes to its polarity and solubility in polar solvents, enhancing its utility in biological and chemical applications. Additionally, the stereochemistry indicated by the (2R) configuration suggests specific spatial arrangements that can influence the compound's reactivity and interactions with biological targets. Overall, (2R)-5-Bromo-2,3-dihydro-1H-inden-2-ol is a versatile compound with potential implications in synthetic organic chemistry and pharmacology.

Formula: C₉H₉BrO

InChI: InChI=1S/C9H9BrO/c10-8-2-1-6-4-9(11)5-7(6)3-8/h1-3,9,11H,4-5H2/t9-/m1/s1

InChI key: InChIKey=QYVONEHTDRTAHN-SECBINFHSA-N

SMILES: O[C@@H]1CC=2C(C1)=CC(Br)=CC2

Synonyms:

• 1H-Inden-2-ol, 5-bromo-2,3-dihydro-, (2R)-
• (2R)-5-Bromo-2,3-dihydro-1H-inden-2-ol

(R)-5-Bromo-2,3-dihydro-1H-inden-2-ol

Controlled Product

CAS: 1246816-01-2

Formula: C₉H₉BrO

Color and Shape: Neat

Molecular weight: 213.071

Ref: TR-B684065