
CAS 1246816-18-1
:Methanesulfonothioic acid, S-(12-aminododecyl) ester, hydrochloride (1:1)
Description:
Methanesulfonothioic acid, S-(12-aminododecyl) ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a methanesulfonothioic acid moiety linked to a long-chain alkyl group (specifically, a dodecyl chain) and an amino group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the amino group suggests potential for biological activity, possibly interacting with various biological systems. Its methanesulfonothioic acid component may impart properties such as reactivity with nucleophiles or participation in various chemical reactions, making it of interest in both synthetic and medicinal chemistry. As with many chemical substances, safety data should be consulted, as it may pose hazards depending on its concentration and exposure routes. Overall, this compound's unique structure and properties make it a subject of interest in research and potential applications in various fields.
Formula:C13H29NO2S2·ClH
InChI:InChI=1S/C13H29NO2S2.ClH/c1-18(15,16)17-13-11-9-7-5-3-2-4-6-8-10-12-14;/h2-14H2,1H3;1H
InChI key:InChIKey=IVFMIMTUMQDTEH-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCN)CSS(C)(=O)=O.Cl
Synonyms:- Methanesulfonothioic acid, S-(12-aminododecyl) ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
12-Aminododecyl Methanethiosulfonate Hydrochloride
CAS:Controlled ProductApplications Reacts specifically and rapidly with thiols to form mixed disulfides.
References Xu, M. & Akabus, M.H.: J. Biol. Chem., 268, 21505 (1993), Duhten, R.L., et al.: Biochemistry, 32, 3139 (1993), Yang, N. et al.: Neuron, 16, 113 (1996), Kuner, T. et al.: Neuron, 17, 343 (1996), Mascia, M.P., et al.: P. Natl. Acad. Sci., 97, 16, 9305 (2000)Formula:C13H30ClNO2S2Color and Shape:NeatMolecular weight:331.97
