CAS 1246817-52-6

2,6-Deoxyfructosazine-13C4

Description:

2,6-Deoxyfructosazine-13C4 is a chemical compound that belongs to the class of carbohydrates, specifically a derivative of fructose. It is characterized by the presence of deoxy groups at the 2 and 6 positions of the fructose molecule, which alters its reactivity and biological properties compared to its parent compound. The "13C4" designation indicates that this compound contains four carbon-13 isotopes, making it useful in various applications, including metabolic studies and tracer experiments in biochemistry. The compound's structure influences its solubility, stability, and interaction with biological systems, which can be significant in research related to metabolism and carbohydrate chemistry. As with many carbohydrate derivatives, it may exhibit specific optical activity and participate in various chemical reactions, including glycosylation and oxidation. Its unique isotopic labeling allows for enhanced tracking in analytical techniques such as NMR spectroscopy and mass spectrometry, providing insights into metabolic pathways and interactions in biological systems.

Formula: C₁₂H₂₀N₂O₇

InChI: InChI=1/C12H20N2O7/c15-4-9(18)8(17)1-6-2-13-3-7(14-6)11(20)12(21)10(19)5-16/h2-3,8-12,15-21H,1,4-5H2/t8-,9+,10+,11+,12+/s2/i2+1,3+1,6+1,7+1

InChI key: InChIKey=MBHUNOHYVYVNIP-BRCZIWPZNA-N

SMILES: [C@@H]([C@@H]([C@@H](CO)O)O)(O)[13C]1=N[13C](C[C@@H]([C@@H](CO)O)O)=[13CH]N=[13CH]1

Synonyms:

• 2,6-Deoxyfructosazine-13C4
• 2-(D-arabino-1',2',3',4'-Tetrahydroxybutyl)-6-(D-erythro-2'',3'',4''-trihydroxybutyl)pyrazine-13C4
• 1R,2S,3R)-1-[6-[(2S,3R)-2,3,4-Trihydroxybutyl]-2-pyrazinyl]-1,2,3,4-butanetetrol-13C4

2,6-Deoxyfructosazine-13C4

Controlled Product

CAS: 1246817-52-6

Applications Labelled 2,6-Deoxyfructosazine. Contained in tobacco flavor additives.
References Tsuchida, H., et al.: Agric. Biol. Chem., 40, 921 (1976),

Formula: C₈C₄H₂₀N₂O₇

Color and Shape: Neat

Molecular weight: 308.27

Ref: TR-D235802