CAS 1246819-05-5
:Ethyl 2-[(3,5-dichloro-8-quinolinyl)oxy]acetate
Description:
Ethyl 2-[(3,5-dichloro-8-quinolinyl)oxy]acetate is a chemical compound characterized by its unique structure, which includes an ethyl ester functional group and a quinoline moiety substituted with dichloro groups. This compound typically exhibits properties associated with both esters and heterocyclic aromatic compounds. It is likely to be a solid or liquid at room temperature, depending on its molecular weight and structure. The presence of the quinoline ring suggests potential biological activity, as many quinoline derivatives are known for their pharmacological properties, including antimicrobial and antimalarial effects. The dichloro substitutions can enhance the compound's reactivity and influence its solubility in various solvents. Additionally, the ester functional group may participate in hydrolysis reactions under acidic or basic conditions. Safety data should be consulted for handling and storage, as compounds with halogenated groups can pose environmental and health risks. Overall, this compound's characteristics make it of interest in both synthetic chemistry and potential medicinal applications.
Formula:C13H11Cl2NO3
InChI:InChI=1S/C13H11Cl2NO3/c1-2-18-12(17)7-19-11-4-3-10(15)9-5-8(14)6-16-13(9)11/h3-6H,2,7H2,1H3
InChI key:InChIKey=ALLATOGUWSCHBO-UHFFFAOYSA-N
SMILES:O(CC(OCC)=O)C=1C2=C(C(Cl)=CC1)C=C(Cl)C=N2
Synonyms:- Ethyl 2-[(3,5-dichloro-8-quinolinyl)oxy]acetate
- Acetic acid, 2-[(3,5-dichloro-8-quinolinyl)oxy]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.