CymitQuimica logo

CAS 1246819-45-3

:

1-[4-[4-(Methoxymethoxy)phenyl]-1-piperazinyl]ethanone

Description:
1-[4-[4-(Methoxymethoxy)phenyl]-1-piperazinyl]ethanone, identified by its CAS number 1246819-45-3, is a chemical compound characterized by its complex structure that includes a piperazine ring, which is a common motif in pharmacologically active compounds. The presence of a methoxymethoxy group suggests that it may exhibit unique solubility and electronic properties, potentially influencing its biological activity. This compound likely possesses a ketone functional group, which can participate in various chemical reactions, including nucleophilic additions. Its phenyl groups may contribute to hydrophobic interactions, enhancing its affinity for biological targets. The overall molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders, given the piperazine moiety's prevalence in such drugs. However, specific biological activities, toxicity, and pharmacokinetic properties would require empirical investigation to fully understand its potential applications and safety profile.
Formula:C14H20N2O3
InChI:InChI=1S/C14H20N2O3/c1-12(17)15-7-9-16(10-8-15)13-3-5-14(6-4-13)19-11-18-2/h3-6H,7-11H2,1-2H3
InChI key:InChIKey=JGTPWPCAOYUPAB-UHFFFAOYSA-N
SMILES:O(COC)C1=CC=C(C=C1)N2CCN(C(C)=O)CC2
Synonyms:
  • 1-[4-[4-(Methoxymethoxy)phenyl]-1-piperazinyl]ethanone
  • Ethanone, 1-[4-[4-(methoxymethoxy)phenyl]-1-piperazinyl]-
  • 1-Acetyl-4-[4-(MethoxyMethoxy)phenyl]piperazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.