CAS 1246819-72-6
:4-(methylamino)-1-pyridin-3-ylbutan-1-one
Description:
4-(Methylamino)-1-pyridin-3-ylbutan-1-one, identified by its CAS number 1246819-72-6, is a chemical compound that belongs to the class of substituted pyridines. This substance features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and is substituted with a butanone chain and a methylamino group. The presence of the methylamino group suggests potential basic properties, as amines can act as nucleophiles and participate in various chemical reactions. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or psychiatric conditions. Its molecular structure indicates that it could interact with neurotransmitter systems, although specific pharmacological effects would require empirical investigation. Additionally, the compound's solubility, stability, and reactivity would depend on environmental conditions such as pH and temperature. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C10H14N2O
InChI:InChI=1S/C10H14N2O/c1-11-6-3-5-10(13)9-4-2-7-12-8-9/h2,4,7-8,11H,3,5-6H2,1H3/i2+1,4+1,7+1,8+1,9+1,10+1
InChI key:InChIKey=SGDIDUFQYHRMPR-SQXBKTHVSA-N
SMILES:[13C](CCCNC)(=O)[13C]=1[13CH]=[13CH][13CH]=N[13CH]1
Synonyms:- [1,2',3',4',5',6'-13C6]-3- (4-Methylaminobutyryl)pyridine Dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(4-Methylaminobutyryl)pyridine-1,2',3',4',5',6'-13C6, Dihydrochloride
CAS:Controlled ProductStability Hygroscopic
Applications An amino alcohol metabolite of nicotine, and precursor to NNK.Formula:C413C6H16Cl2N2OColor and Shape:NeatMolecular weight:257.11
