CAS 1246820-63-2
:Methyl γ-(methylnitrosoamino)-3-pyridinebutanoate
Description:
Methyl γ-(methylnitrosoamino)-3-pyridinebutanoate, identified by its CAS number 1246820-63-2, is a synthetic organic compound that belongs to the class of nitrosoamines, which are known for their potential carcinogenic properties. This compound features a pyridine ring, which contributes to its aromatic characteristics, and a butanoate moiety that influences its solubility and reactivity. The presence of the nitroso group (-NO) is significant, as it can participate in various chemical reactions, including alkylation and nitrosation processes. Methyl γ-(methylnitrosoamino)-3-pyridinebutanoate is typically studied in the context of its biological effects, particularly its role in the formation of DNA adducts, which can lead to mutations and cancer. Its stability, reactivity, and interactions with biological systems make it a compound of interest in toxicology and pharmacology. Proper handling and safety measures are essential when working with this substance due to its potential health risks.
Formula:C11H15N3O3
InChI:InChI=1S/C11H15N3O3/c1-14(13-16)10(5-6-11(15)17-2)9-4-3-7-12-8-9/h3-4,7-8,10H,5-6H2,1-2H3
InChI key:InChIKey=VDXNGCZIFPGSRJ-UHFFFAOYSA-N
SMILES:C(CCC(OC)=O)(N(N=O)C)C=1C=CC=NC1
Synonyms:- 3-Pyridinebutanoic acid, γ-(methylnitrosoamino)-, methyl ester
- Methyl γ-(methylnitrosoamino)-3-pyridinebutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(Methylnitrosamino)-4-(3-pyridyl)butyric Acid Methyl Ester
CAS:Controlled ProductApplications Intermediate in the production of carcinogenic compounds found in tobacco smoke
Formula:C11H15N3O3Color and Shape:ColourlessMolecular weight:237.26
