
CAS 1246833-81-7
:Description:
The chemical substance with the CAS number 1246833-81-7 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties, including molecular weight, solubility, boiling and melting points, and reactivity, which are influenced by their molecular structure and functional groups. Such substances may be used in various applications, including pharmaceuticals, agrochemicals, or materials science, depending on their chemical nature. To obtain precise characteristics, including safety data, handling procedures, and potential applications, it is advisable to consult specialized chemical databases, scientific literature, or safety data sheets (SDS) related to the specific compound. If you have access to a chemical database or scientific resources, you may find more detailed and specific information regarding this compound's properties and uses.
Formula:C21H18D3N·ClH
InChI:InChI=1S/C21H21N.ClH/c1-22(16-8-11-18-9-3-2-4-10-18)17-20-14-7-13-19-12-5-6-15-21(19)20;/h2-15H,16-17H2,1H3;1H/i1D3;
InChI key:InChIKey=OLUNPKFOFGZHRT-NIIDSAIPSA-N
SMILES:C(N(CC=CC1=CC=CC=C1)C([2H])([2H])[2H])C=2C3=C(C=CC2)C=CC=C3.Cl
Synonyms:- N-(Naphthalen-1-ylmethyl)-3-phenyl-N-(trideuteriomethyl)prop-2-en-1-amine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Naftifine-d3 Hydrochloride
CAS:Controlled ProductFormula:C21H19D3ClNColor and Shape:NeatMolecular weight:326.88Naftifine-d3 hydrochloride
CAS:Controlled ProductNaftifine-d3 is an analytical standard for HPLC. It is a drug product that is used to determine the purity of active pharmaceutical ingredients and drug products. Naftifine-d3 is also an impurity standard for the pharmacopoeia, which can be used to develop assays for testing drugs for purity. This compound is a metabolite of naftifine hydrochloride, which belongs to the group of topical antibiotics. Naftifine-d3 has been found in natural sources such as plants and fungi. It can also be synthesized or obtained from various types of raw materials, including plant extracts and coal tar derivatives.
Formula:C21H19D3ClNPurity:Min. 95%Molecular weight:326.88 g/mol


