CymitQuimica logo

CAS 1246834-00-3

:

1,1-Dimethylethyl N-[2-[1-(hydroxyimino)-3-methylbutyl]phenyl]carbamate

Description:
1,1-Dimethylethyl N-[2-[1-(hydroxyimino)-3-methylbutyl]phenyl]carbamate, identified by its CAS number 1246834-00-3, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by the presence of a carbamate functional group, which is known for its applications in agriculture as a pesticide or herbicide. The compound also contains a hydroxyimino group, which can enhance its reactivity and potential biological activity. Its molecular structure suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and agrochemical research. The presence of bulky groups, such as the tert-butyl moiety, may influence its solubility and stability in various environments. Additionally, the compound's potential applications could be explored in fields such as crop protection or pharmaceuticals, depending on its efficacy and safety profile. As with any chemical, understanding its properties, including solubility, stability, and reactivity, is crucial for its practical applications.
Formula:C16H24N2O3
InChI:InChI=1S/C16H24N2O3/c1-11(2)10-14(18-20)12-8-6-7-9-13(12)17-15(19)21-16(3,4)5/h6-9,11,20H,10H2,1-5H3,(H,17,19)
InChI key:InChIKey=AKZYIZTWBFHYFZ-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=C(C(CC(C)C)=NO)C=CC=C1
Synonyms:
  • 1,1-Dimethylethyl N-[2-[1-(hydroxyimino)-3-methylbutyl]phenyl]carbamate
  • Carbamic acid, N-[2-[1-(hydroxyimino)-3-methylbutyl]phenyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.