CAS 124687-35-0
:4-amino-5-fluoro-3-phenylpentanoic acid
Description:
4-Amino-5-fluoro-3-phenylpentanoic acid is an organic compound characterized by its amino acid structure, which includes an amino group (-NH2), a carboxylic acid group (-COOH), and a phenyl group attached to a pentanoic acid backbone. The presence of a fluorine atom at the 5-position contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound is likely to exhibit polar characteristics due to the amino and carboxylic acid functional groups, which can engage in hydrogen bonding. The phenyl group adds hydrophobic character, affecting solubility in various solvents. As an amino acid derivative, it may play a role in biochemical processes or serve as a building block in peptide synthesis. Its specific applications could range from pharmaceuticals to research in biochemistry, particularly in studies involving amino acid metabolism or drug design. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H15ClFNO2
InChI:InChI=1/C11H14FNO2.ClH/c12-7-10(13)9(6-11(14)15)8-4-2-1-3-5-8;/h1-5,9-10H,6-7,13H2,(H,14,15);1H/t9-,10+;/m1./s1
Synonyms:- (3R,4R)-4-amino-5-fluoro-3-phenylpentanoic acid hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenepropanoic acid, β-[(1S)-1-amino-2-fluoroethyl]-, hydrochloride (1:1), (βS)-rel-
CAS:Formula:C11H15ClFNO2Molecular weight:247.6937
