
CAS 124688-06-8
:2,3-Dihydro-5-methoxy-2,2-dimethyl-1H-inden-1-one
Description:
2,3-Dihydro-5-methoxy-2,2-dimethyl-1H-inden-1-one, with the CAS number 124688-06-8, is an organic compound characterized by its unique bicyclic structure, which includes an indene framework. This compound features a methoxy group (-OCH3) and two methyl groups (-CH3) attached to the indene ring, contributing to its distinct chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity, particularly in electrophilic aromatic substitution reactions. The compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many organic compounds, safety precautions should be observed when handling it, given the potential for toxicity or reactivity.
Formula:C12H14O2
InChI:InChI=1S/C12H14O2/c1-12(2)7-8-6-9(14-3)4-5-10(8)11(12)13/h4-6H,7H2,1-3H3
InChI key:InChIKey=ZENPNFPJVPODJW-UHFFFAOYSA-N
SMILES:O=C1C=2C(CC1(C)C)=CC(OC)=CC2
Synonyms:- 1H-Inden-1-one, 2,3-dihydro-5-methoxy-2,2-dimethyl-
- 2,3-Dihydro-5-methoxy-2,2-dimethyl-1H-inden-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.