CAS 1246926-09-9

5,7-Dihydroxy-2-[4-hydroxy-3-(4-hydroxy-3-methylbutyl)-5-(3-methyl-2-buten-1-yl)phenyl]-3,6-dimethoxy-4H-1-benzopyran-4-one

Description:

5,7-Dihydroxy-2-[4-hydroxy-3-(4-hydroxy-3-methylbutyl)-5-(3-methyl-2-buten-1-yl)phenyl]-3,6-dimethoxy-4H-1-benzopyran-4-one, with CAS number 1246926-09-9, is a complex organic compound belonging to the flavonoid class, characterized by its polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties, and methoxy groups that may influence its solubility and reactivity. The presence of various substituents, including a 3-methyl-2-buten-1-yl group, suggests that it may exhibit unique biological activities, possibly including anti-inflammatory or anticancer effects. Its intricate structure indicates potential interactions with biological macromolecules, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are crucial for its application in research and potential therapeutic uses. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₂₇H₃₂O₈

InChI: InChI=1S/C27H32O8/c1-14(2)6-8-16-10-18(11-17(22(16)30)9-7-15(3)13-28)25-27(34-5)24(32)21-20(35-25)12-19(29)26(33-4)23(21)31/h6,10-12,15,28-31H,7-9,13H2,1-5H3

InChI key: InChIKey=HZKQZIBQTUUPIQ-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC=2C(C1=O)=C(O)C(OC)=C(O)C2)C3=CC(CCC(CO)C)=C(O)C(CC=C(C)C)=C3

Synonyms:

• 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-[4-hydroxy-3-(4-hydroxy-3-methylbutyl)-5-(3-methyl-2-buten-1-yl)phenyl]-3,6-dimethoxy-
• 5′-Prenylaliarin
• 5,7-Dihydroxy-2-[4-hydroxy-3-(4-hydroxy-3-methylbutyl)-5-(3-methyl-2-buten-1-yl)phenyl]-3,6-dimethoxy-4H-1-benzopyran-4-one
• 5,7,4′-Trihydroxy-3′-(4-hydroxy-3-methylbutyl)-5′-(3-methylbut-2-enyl)-3,6-dimethoxyflavone

4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-[4-hydroxy-3-(4-hydroxy-3-methylbutyl)-5-(3-methyl-2-buten-1-yl)phenyl]-3,6-dimethoxy-

CAS: 1246926-09-9

Formula: C₂₇H₃₂O₈

Purity: powder

Molecular weight: 484.5382

Ref: IN-DA000MMO

5'-Prenylaliarin

CAS: 1246926-09-9

5'-Prenylaliarin is a natural product for research related to life sciences. The catalog number is TN3137 and the CAS number is 1246926-09-9.

Formula: C₂₇H₃₂O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 484.54

Ref: TM-TN3137

5'-Prenylaliarin

CAS: 1246926-09-9

Formula: C₂₇H₃₂O₈

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 484.545

Ref: BP-SBP02664

5'-Prenylaliarin

CAS: 1246926-09-9

5'-Prenylaliarin is a prenylated flavonoid, which is a naturally occurring secondary metabolite found in various plant species. This compound is typically sourced from plants known for their bioactive potential, particularly those within the Asteraceae family. The prenyl group attached to the flavonoid backbone enhances the compound's lipophilicity, which may influence its bioavailability and interaction with cellular membranes.

Formula: C₂₇H₃₂O₈

Purity: Min. 95%

Molecular weight: 484.5 g/mol

Ref: 3D-WZB92609