
CAS 1247-19-4
:1,1′-(Diphenoxysilylene)bis[benzene]
Description:
1,1′-(Diphenoxysilylene)bis[benzene], with the CAS number 1247-19-4, is an organosilicon compound characterized by its unique structure, which features a silicon atom bonded to two phenoxy groups and two benzene rings. This compound exhibits properties typical of organosilicon materials, including thermal stability and potential for forming siloxane linkages. Its molecular structure contributes to its ability to act as a bridging agent in polymer networks, enhancing mechanical properties and thermal resistance. The presence of aromatic rings provides rigidity and contributes to its electronic properties, making it of interest in various applications, including materials science and organic electronics. Additionally, the compound's solubility and reactivity can be influenced by the substituents on the benzene rings, allowing for further functionalization. Overall, 1,1′-(Diphenoxysilylene)bis[benzene] is notable for its potential utility in advanced materials and chemical synthesis, where its unique characteristics can be leveraged for innovative applications.
Formula:C24H20O2Si
InChI:InChI=1S/C24H20O2Si/c1-5-13-21(14-6-1)25-27(23-17-9-3-10-18-23,24-19-11-4-12-20-24)26-22-15-7-2-8-16-22/h1-20H
InChI key:InChIKey=YLDKQPMORVEBRU-UHFFFAOYSA-N
SMILES:[Si](OC1=CC=CC=C1)(OC2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- 1,1′-(Diphenoxysilylene)bis[benzene]
- Diphenyldiphenoxysilane
- Silane, diphenoxydiphenyl-
- Diphenoxydiphenylsilane
- Benzene, 1,1′-(diphenoxysilylene)bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
