CAS 124700-40-9

2-Fluoro-4-iodobenzoic acid

Description:

2-Fluoro-4-iodobenzoic acid is an aromatic carboxylic acid characterized by the presence of both a fluorine and an iodine atom on the benzene ring, specifically at the 2 and 4 positions, respectively. This compound features a carboxylic acid functional group (-COOH), which contributes to its acidic properties. The presence of halogens, such as fluorine and iodine, can significantly influence the compound's reactivity, polarity, and solubility. Generally, the fluorine atom can enhance the compound's electron-withdrawing ability, while iodine, being larger and less electronegative, may affect steric hindrance and reactivity in nucleophilic substitution reactions. 2-Fluoro-4-iodobenzoic acid is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique combination of functional groups makes it a valuable compound for studying the effects of halogen substitution on chemical behavior and reactivity in various chemical reactions.

Formula: C₇H₄FIO₂

InChI: InChI=1/C7H4FIO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11)

SMILES: c1cc(c(cc1I)F)C(=O)O

Synonyms:

• Benzoic acid, 2-fluoro-4-iodo-
• 4-Iodo-2-Fluorobenzoic Acid

Benzoic acid, 2-fluoro-4-iodo-

CAS: 124700-40-9

Formula: C₇H₄FIO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 266.0083

Ref: IN-DA000MMT

2-Fluoro-4-iodobenzoic acid

CAS: 124700-40-9

2-Fluoro-4-iodobenzoic acid

Formula: C₇H₄FIO₂

Purity: 95%

Color and Shape: light brown crystalline solid

Molecular weight: 266.01g/mol

Ref: 54-PC2740

2-Fluoro-4-iodobenzoic acid

CAS: 124700-40-9

Formula: C₇H₄FIO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 266.01

Ref: 10-F038270