CymitQuimica logo

CAS 124701-11-7

:

3-Ethyl-2-thiophenamine

Description:
3-Ethyl-2-thiophenamine is an organic compound characterized by the presence of both an ethyl group and a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amine functional group, indicating its potential as a nucleophile and its ability to participate in various chemical reactions, such as alkylation and acylation. The presence of the ethyl group contributes to its hydrophobic character, while the thiophene ring can engage in π-π stacking interactions, enhancing its stability and reactivity in certain contexts. 3-Ethyl-2-thiophenamine may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its solubility properties can vary depending on the solvent, and it may be sensitive to oxidation due to the presence of the thiophene moiety. Overall, this compound's unique structure and functional groups make it a versatile candidate for further research and application in various chemical fields.
Formula:C6H9NS
InChI:InChI=1S/C6H9NS/c1-2-5-3-4-8-6(5)7/h3-4H,2,7H2,1H3
InChI key:InChIKey=OAOSOXNBIUHVLW-UHFFFAOYSA-N
SMILES:C(C)C1=C(N)SC=C1
Synonyms:
  • 3-Ethylthiophen-2-amine
  • 3-Ethyl-2-thiophenamine
  • 2-Thiophenamine, 3-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.