CAS 124704-83-2
:kukulkanin B
Description:
Kukulkanin B is a chemical compound classified as a natural product, specifically a type of flavonoid. It is derived from certain plant sources and is known for its potential biological activities, including antioxidant and anti-inflammatory properties. The compound features a complex structure typical of flavonoids, which often includes multiple hydroxyl groups and a phenolic backbone, contributing to its reactivity and interaction with biological systems. Kukulkanin B has garnered interest in pharmacological research due to its potential therapeutic applications, although detailed studies on its mechanisms of action and efficacy are still ongoing. As with many natural products, its extraction and purification from plant sources can be challenging, and its stability may vary depending on environmental conditions. Further research is necessary to fully elucidate its properties, potential health benefits, and applications in medicine or industry.
Formula:C16H14O5
InChI:InChI=1/C16H14O5/c1-21-16-14(19)9-7-12(15(16)20)13(18)8-4-10-2-5-11(17)6-3-10/h2-9,17,19-20H,1H3/b8-4+
Synonyms:- 2',4',4-Trihydroxy-3'-methoxyxchalcone
- 2-Propen-1-one, 1-(2,4-dihydroxy-3-methoxyphenyl)-3-(4-hydroxyphenyl)-, (E)-
- (2E)-1-(2,4-dihydroxy-3-methoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one
- Kukulkanin B
- 2-Propen-1-one, 1-(2,4-dihydroxy-3-methoxyphenyl)-3-(4-hydroxyphenyl)-, (2E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Kukulkanin B
CAS:Kukulkanin B is a bioactive compound that belongs to the diterpene class of natural products. It is derived from the plant species belonging to the genus Croton, commonly found in tropical regions. This compound is synthesized through the complex secondary metabolite pathways in plants, resulting in a structure that exhibits potent biological activities.Formula:C16H14O5Purity:Min. 95%Molecular weight:286.28 g/mol
