
CAS 1247082-60-5
:N-Cyclobutyl-3-fluoro-4-methoxybenzenamine
Description:
N-Cyclobutyl-3-fluoro-4-methoxybenzenamine is an organic compound characterized by its unique molecular structure, which includes a cyclobutyl group, a fluorine atom, and a methoxy group attached to a benzene ring. The presence of the amino group (-NH2) indicates that it is an amine, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The fluorine atom contributes to the compound's potential reactivity and may influence its electronic properties, making it useful in medicinal chemistry and material science. The methoxy group enhances the compound's solubility and can affect its biological activity. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall stability of the compound in various environments. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H14FNO
InChI:InChI=1S/C11H14FNO/c1-14-11-6-5-9(7-10(11)12)13-8-3-2-4-8/h5-8,13H,2-4H2,1H3
InChI key:InChIKey=BYLWAHFEXYRBFE-UHFFFAOYSA-N
SMILES:N(C1=CC(F)=C(OC)C=C1)C2CCC2
Synonyms:- Benzenamine, N-cyclobutyl-3-fluoro-4-methoxy-
- N-Cyclobutyl-3-fluoro-4-methoxybenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.