CAS 1247119-31-8: 2,5-Hexanediamine, 1,6-diphenyl-, hydrochloride (1:2), (2R,5R)-
Description:2,5-Hexanediamine, 1,6-diphenyl-, hydrochloride (1:2), (2R,5R)- is a chemical compound characterized by its amine functional groups and a specific stereochemistry. This substance is a hydrochloride salt, indicating that it is formed by the reaction of the base 2,5-hexanediamine with hydrochloric acid. The presence of two phenyl groups attached to the hexanediamine backbone contributes to its unique properties, including potential applications in organic synthesis and materials science. The (2R,5R) designation refers to the specific stereoisomerism of the molecule, which can influence its reactivity and interaction with biological systems. As a diamine, it can participate in various chemical reactions, such as polymerization and cross-linking, making it valuable in the production of polyamides and other polymers. Safety data should be consulted for handling and storage, as amines can be hazardous. Overall, this compound's structural features and functional groups make it an interesting subject for further research in both industrial and academic settings.
Formula:C18H24N2·2ClH
InChI:InChI=1S/C18H24N2.2ClH/c19-17(13-15-7-3-1-4-8-15)11-12-18(20)14-16-9-5-2-6-10-16;;/h1-10,17-18H,11-14,19-20H2;2*1H/t17-,18-;;/m1../s1
InChI key:InChIKey=XTTBTZPGZLVADL-RKDOVGOJSA-N
SMILES:Cl.NC(CC=1C=CC=CC1)CCC(N)CC=2C=CC=CC2
- Synonyms:
- (2R,5R)-1,6-Diphenyl-2,5-hexanediamine hydrochloride
- (2R,5R)-1,6-Diphenyl hexane-2,5-diamine dihydrochloride
- 2,5-Hexanediamine, 1,6-diphenyl-, hydrochloride (1:2), (2R,5R)-