CAS 124716-15-0
:N-(N-(4-deoxy-4-amino-10-methylpteroyl)-4-fluoroglutamyl)-gamma-glutamate
Description:
N-(N-(4-deoxy-4-amino-10-methylpteroyl)-4-fluoroglutamyl)-gamma-glutamate, with the CAS number 124716-15-0, is a synthetic compound that belongs to the class of folate derivatives. This substance is characterized by its complex structure, which includes a pteridine ring, an amino acid moiety, and a fluorinated glutamate component. The presence of the 4-deoxy-4-amino group indicates that it is a modified form of folate, which is essential for various biological processes, including DNA synthesis and repair. The fluorine substitution at the 4-position of the glutamate moiety may influence its biological activity and pharmacokinetics. This compound is of interest in medicinal chemistry and biochemistry, particularly in the context of cancer research and drug development, as it may exhibit properties that enhance the efficacy of antifolate therapies. Its solubility, stability, and interaction with biological targets are critical factors that determine its potential applications in therapeutic settings.
Formula:C25H28FN9O8
InChI:InChI=1/C25H28FN9O8/c1-35(10-12-9-29-20-18(30-12)19(27)33-25(28)34-20)13-4-2-11(3-5-13)21(38)32-16(24(42)43)8-14(26)22(39)31-15(23(40)41)6-7-17(36)37/h2-5,9,14-16H,6-8,10H2,1H3,(H,31,39)(H,32,38)(H,36,37)(H,40,41)(H,42,43)(H4,27,28,29,33,34)
SMILES:CN(Cc1cnc2c(c(N)[nH]c(=N)n2)n1)c1ccc(cc1)C(=O)NC(CC(C(=NC(CCC(=O)O)C(=O)O)O)F)C(=O)O
Synonyms:- Mfgg
- N-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}benzoyl)-4-fluoro-gamma-glutamylglutamic acid
- N-(N-(4-Deoxy-4-amino-10-methylpteroyl)-4-fluoroglutamyl)-gamma-glutamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.