CAS 124728-45-6

Benzoic acid, 4-ethoxy-2,3-difluoro- (9CI)

Description:

Benzoic acid, 4-ethoxy-2,3-difluoro- (9CI), with the CAS number 124728-45-6, is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with an ethoxy group and two fluorine atoms at the 2 and 3 positions of the aromatic ring. This compound typically exhibits properties associated with benzoic acids, such as being a white crystalline solid at room temperature. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of fluorine atoms can enhance lipophilicity and influence the compound's reactivity and biological activity. Additionally, the ethoxy group may affect solubility and stability in different solvents. As with many fluorinated compounds, it may exhibit unique characteristics in terms of chemical reactivity and interaction with biological systems. Safety data should be consulted for handling and usage, as the presence of fluorine and the carboxylic acid functional group can impart specific hazards.

Formula: C₉H₈F₂O₃

InChI: InChI=1/C9H8F2O3/c1-2-14-6-4-3-5(9(12)13)7(10)8(6)11/h3-4H,2H2,1H3,(H,12,13)

SMILES: CCOc1ccc(c(c1F)F)C(=O)O

Synonyms:

• 2,3-Difluoro-4-ethoxybenzoic acid
• 4-Ethoxy-2,3-Difluorobenzoic Acid

Benzoic acid, 4-ethoxy-2,3-difluoro-

CAS: 124728-45-6

Formula: C₉H₈F₂O₃

Purity: %

Color and Shape: Solid

Molecular weight: 202.1548

Ref: IN-DA000MOB

2,3-Difluoro-4-ethoxybenzoic acid

CAS: 124728-45-6

2,3-Difluoro-4-ethoxybenzoic acid

Formula: C₉H₈F₂O₃

Purity: 97%

Molecular weight: 202.15g/mol

Ref: 54-PC7871

2,3-Difluoro-4-ethoxybenzoic acid

CAS: 124728-45-6

Formula: C₉H₈F₂O₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 202.157

Ref: 10-F013020

2,3-Difluoro-4-ethoxybenzoic acid

CAS: 124728-45-6

2,3-Difluoro-4-ethoxybenzoic acid is a versatile building block that can be used in the synthesis of complex compounds. It is also useful as a research chemical and reagent. 2,3-Difluoro-4-ethoxybenzoic acid is an intermediate for the preparation of other compounds, as well as being a useful scaffold for organic synthesis. This compound has been assigned CAS No. 124728-45-6.

Formula: C₉H₈F₂O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 202.15 g/mol

Ref: 3D-FD66766