
CAS 124729-23-3
:6-Pentyl-3-pyridinol
Description:
6-Pentyl-3-pyridinol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a pentyl side chain at the 6-position and a hydroxyl group (-OH) at the 3-position of the pyridine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the hydroxyl group makes it a polar molecule, which can influence its solubility in various solvents. 6-Pentyl-3-pyridinol is known for its potential applications in the field of agrochemicals, particularly as a plant growth regulator or in pest control formulations. Its biological activity may be linked to its ability to interact with specific receptors or enzymes in target organisms. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks if ingested or improperly handled. Overall, 6-Pentyl-3-pyridinol represents a compound of interest in both synthetic and applied chemistry contexts.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-2-3-4-5-9-6-7-10(12)8-11-9/h6-8,12H,2-5H2,1H3
InChI key:InChIKey=KPYULRJEQCKVFY-UHFFFAOYSA-N
SMILES:C(CCCC)C1=CC=C(O)C=N1
Synonyms:- 3-Pyridinol, 6-pentyl-
- 6-Pentyl-3-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.