CAS 124730-02-5

2-(2,4-Dimethylphenyl)-4,5-dihydro-1H-imidazole

Description:

2-(2,4-Dimethylphenyl)-4,5-dihydro-1H-imidazole is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a dimethylphenyl substituent, indicating the presence of a phenyl group with two methyl groups at the 2 and 4 positions, contributing to its hydrophobic character and potential for various interactions. The dihydro form of the imidazole ring suggests that it is partially saturated, which can influence its reactivity and stability. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The presence of the dimethylphenyl group can enhance lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. Additionally, the specific arrangement of substituents can lead to unique electronic properties, influencing how the compound interacts with other molecules. Overall, this compound's structural features suggest it may have applications in medicinal chemistry or as a building block in organic synthesis.

Formula: C₁₁H₁₄N₂

InChI: InChI=1S/C11H14N2/c1-8-3-4-10(9(2)7-8)11-12-5-6-13-11/h3-4,7H,5-6H2,1-2H3,(H,12,13)

InChI key: InChIKey=BPDHWJWTERFDRD-UHFFFAOYSA-N

SMILES: CC1=C(C=2NCCN2)C=CC(C)=C1

Synonyms:

• 2-(2,4-Dimethylphenyl)-4,5-dihydro-1H-imidazole
• 1H-Imidazole, 2-(2,4-dimethylphenyl)-4,5-dihydro-