CAS 124730-53-6

ethyl 5,6-dihydro-4H-pyrrolo[3,2,1-ij]quinoline-1-carboxylate

Description:

Ethyl 5,6-dihydro-4H-pyrrolo[3,2,1-ij]quinoline-1-carboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and quinoline moieties. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with various biological targets, which may contribute to its pharmacological properties. The presence of the ethyl ester functional group enhances its solubility and reactivity, potentially influencing its bioavailability and metabolic stability. Additionally, the compound may display fluorescence properties, which can be useful in analytical applications. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and π-π stacking interactions, affecting its behavior in biological systems. Overall, ethyl 5,6-dihydro-4H-pyrrolo[3,2,1-ij]quinoline-1-carboxylate represents a versatile scaffold for further chemical modifications and investigations into its therapeutic potential.

Formula: C₁₄H₁₅NO₂

InChI: InChI=1/C14H15NO2/c1-2-17-14(16)12-9-15-8-4-6-10-5-3-7-11(12)13(10)15/h3,5,7,9H,2,4,6,8H2,1H3

SMILES: CCOC(=O)c1cn2CCCc3cccc1c23

Synonyms:

• Ethyl 2,3-Dihydro-1H-Pyrrolo[3,2,1-Ij]Quinoline-6-Carboxylate

Ethyl 5,6-dihydro-4H-pyrrolo[3,2,1-ij]quinoline-1-carboxylate

CAS: 124730-53-6

Formula: C₁₄H₁₅NO₂

Molecular weight: 229.2744

Ref: IN-DA000MO5