CAS 124733-25-1
:2-(Methoxydimethylsilyl)thiophene
Description:
2-(Methoxydimethylsilyl)thiophene is an organosilicon compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The compound features a methoxydimethylsilyl group, which contributes to its unique properties, including enhanced solubility and potential reactivity in various chemical environments. This substance is typically used in organic synthesis and materials science, particularly in the development of functionalized polymers and electronic materials. Its structure allows for interesting interactions with other chemical species, making it valuable in applications such as sensors and semiconductors. The presence of the silicon atom in the methoxydimethylsilyl group can also impart stability and modify the electronic properties of the thiophene ring. Overall, 2-(Methoxydimethylsilyl)thiophene is notable for its versatility in chemical applications, driven by its unique structural features and functional groups.
Formula:C7H12OSSi
InChI:InChI=1S/C7H12OSSi/c1-8-10(2,3)7-5-4-6-9-7/h4-6H,1-3H3
InChI key:InChIKey=GIHPJSCKVRNXNV-UHFFFAOYSA-N
SMILES:[Si](OC)(C)(C)C1=CC=CS1
Synonyms:- Thiophene, 2-(methoxydimethylsilyl)-
- Silane, methoxydimethyl-2-thienyl-
- 2-(Methoxydimethylsilyl)thiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
