
CAS 124737-31-1
:Benzenediazonium, 4-(dimethylamino)-, 2-hydroxy-5-sulfobenzoate (1:1)
Description:
Benzenediazonium, 4-(dimethylamino)-, 2-hydroxy-5-sulfobenzoate (1:1), with the CAS number 124737-31-1, is a chemical compound characterized by its complex structure, which includes a diazonium group, a dimethylamino substituent, and a sulfonate moiety. This compound typically exhibits properties associated with both aromatic compounds and diazonium salts, such as high reactivity, particularly in electrophilic aromatic substitution reactions. The presence of the hydroxyl and sulfonate groups enhances its solubility in polar solvents and may impart additional functionalities, such as potential biological activity or reactivity in dye synthesis. The dimethylamino group can influence the electronic properties of the molecule, making it a strong electron donor, which can affect its reactivity and stability. Overall, this compound is of interest in various fields, including organic synthesis, dye chemistry, and potentially in medicinal chemistry, due to its unique structural features and reactivity profile.
Formula:C8H10N3·C7H5O6S
InChI:InChI=1S/C8H10N3.C7H6O6S/c1-11(2)8-5-3-7(10-9)4-6-8;8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h3-6H,1-2H3;1-3,8H,(H,9,10)(H,11,12,13)/q+1;/p-1
InChI key:InChIKey=OWVHHXKGBMBZIY-UHFFFAOYSA-M
SMILES:C([O-])(=O)C1=CC(S(=O)(=O)O)=CC=C1O.N(C)(C)C1=CC=C([N+]#N)C=C1
Synonyms:- Benzenediazonium, 4-(dimethylamino)-, salt with 2-hydroxy-5-sulfobenzoic acid (1:1)
- Benzoic acid, 2-hydroxy-5-sulfo-, ion(1-), 4-(dimethylamino)benzenediazonium
- Benzenediazonium, 4-(dimethylamino)-, 2-hydroxy-5-sulfobenzoate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenediazonium, 4-(dimethylamino)-, 2-hydroxy-5-sulfobenzoate (1:1)
CAS:Formula:C15H15N3O6SMolecular weight:365.3611
