CAS 124741-08-8
:Benzene, (triethoxysilyl)-, homopolymer
Description:
Benzene, (triethoxysilyl)-, homopolymer, identified by CAS number 124741-08-8, is a silane-modified polymer characterized by its unique structure that incorporates both aromatic and siloxane functionalities. This compound typically exhibits excellent thermal stability and chemical resistance, making it suitable for various applications in coatings, adhesives, and sealants. The presence of triethoxysilyl groups enhances its adhesion properties to inorganic substrates, such as glass and metals, while the benzene rings contribute to its mechanical strength and rigidity. Additionally, this polymer can be utilized in the formulation of hybrid materials, combining organic and inorganic components, which can lead to improved performance in terms of durability and environmental resistance. Its versatility allows for modifications in processing and application methods, making it valuable in industries such as construction, automotive, and electronics. Overall, the combination of its structural features imparts a range of beneficial properties, facilitating its use in advanced material science and engineering applications.
Formula:(C12H20O3Si)x
InChI:InChI=1S/C12H20O3Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3
InChI key:InChIKey=JCVQKRGIASEUKR-UHFFFAOYSA-N
SMILES:[Si](OCC)(OCC)(OCC)C1=CC=CC=C1
Synonyms:- Poly(phenyltriethoxysilane)
- Benzene, (triethoxysilyl)-, homopolymer
- Silane, triethoxyphenyl-, homopolymer
- Phenyltriethoxysilane homopolymer
- Poly(triethoxyphenylsilane)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
