
CAS 124750-93-2
:2-Propyl-1-[[2′-(2H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methyl]-4-(trifluoromethyl)-1H-imidazole-5-carboxylic acid
Description:
2-Propyl-1-[[2′-(2H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methyl]-4-(trifluoromethyl)-1H-imidazole-5-carboxylic acid, with CAS number 124750-93-2, is a complex organic compound characterized by its unique structural features. It contains an imidazole ring, which is a five-membered heterocyclic structure known for its biological activity, particularly in pharmaceuticals. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological interactions. The compound also incorporates a tetrazole moiety, which is often associated with various pharmacological properties, including anti-inflammatory and antimicrobial activities. The biphenyl structure contributes to the compound's stability and may affect its electronic properties. This compound is likely to exhibit solubility in organic solvents, and its functional groups suggest potential reactivity in various chemical environments. Overall, its intricate structure positions it as a candidate for research in medicinal chemistry, particularly in the development of novel therapeutic agents.
Formula:C22H19F3N6O2
InChI:InChI=1S/C22H19F3N6O2/c1-2-5-17-26-19(22(23,24)25)18(21(32)33)31(17)12-13-8-10-14(11-9-13)15-6-3-4-7-16(15)20-27-29-30-28-20/h3-4,6-11H,2,5,12H2,1H3,(H,32,33)(H,27,28,29,30)
InChI key:InChIKey=VDRAEBDTPFEPFP-UHFFFAOYSA-N
SMILES:C(N1C(C(O)=O)=C(C(F)(F)F)N=C1CCC)C2=CC=C(C=C2)C3=C(C=CC=C3)C=4NN=NN4
Synonyms:- 1H-Imidazole-5-carboxylic acid, 2-propyl-1-[[2′-(2H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methyl]-4-(trifluoromethyl)-
- 2-Propyl-1-[[2′-(2H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methyl]-4-(trifluoromethyl)-1H-imidazole-5-carboxylic acid
- EXP 3892
- 1H-Imidazole-5-carboxylic acid, 2-propyl-1-[[2′-(1H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methyl]-4-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
EXP3892
CAS:EXP3892 is an angiotensin II receptor antagonist.Formula:C22H19F3N6O2Color and Shape:SolidMolecular weight:456.42
