CymitQuimica logo

CAS 124751-00-4

:

[2-Butyl-4-chloro-1-[(2'-(1-trityl-1H-tetrazol-5-yl)biphenyl-4-yl)methyl]-1H-imidazol-5-yl]methanol

Description:
[2-Butyl-4-chloro-1-[(2'-(1-trityl-1H-tetrazol-5-yl)biphenyl-4-yl)methyl]-1H-imidazol-5-yl]methanol, with CAS number 124751-00-4, is a complex organic compound characterized by its multi-functional structure. It features a butyl group, a chloro substituent, and an imidazole ring, which is known for its biological activity and potential as a pharmacophore. The presence of a tetrazole moiety enhances its chemical stability and may contribute to its interaction with biological targets. The biphenyl structure provides additional steric and electronic properties, which can influence the compound's solubility and reactivity. This compound is likely to exhibit specific pharmacological activities, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography. Overall, the unique combination of functional groups and structural features suggests potential applications in drug development or as a research tool in biochemistry.
Formula:C41H37ClN6O
InChI:InChI=1/C41H37ClN6O/c1-2-3-23-38-43-39(42)37(29-49)47(38)28-30-24-26-31(27-25-30)35-21-13-14-22-36(35)40-44-45-46-48(40)41(32-15-7-4-8-16-32,33-17-9-5-10-18-33)34-19-11-6-12-20-34/h4-22,24-27,49H,2-3,23,28-29H2,1H3
SMILES:CCCCc1nc(c(CO)n1Cc1ccc(cc1)c1ccccc1c1nnnn1C(c1ccccc1)(c1ccccc1)c1ccccc1)Cl
Synonyms:
  • 1H-imidazole-5-methanol, 2-butyl-4-chloro-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-
  • 2-Butyl-4-chloro-5-hydroxymethyl-1-[[2'-(1H-2-triphenylmethyl-tetrazol-5-yl)biphenyl-4-yl]methyl]imidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.